About 3-chloro-8-methoxydecane
3-chloro-8-methoxydecane (PubChem CID 552794) has the molecular formula C11H23ClO
and a molecular weight of 206.76 g/mol. Its IUPAC name is 3-chloro-8-methoxydecane.
Molecular Properties
| Compound Name | 3-chloro-8-methoxydecane |
| PubChem CID | 552794 |
| Molecular Formula | C11H23ClO |
| Molecular Weight | 206.76 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-chloro-8-methoxydecane |
| SMILES | CCC(Cl)CCCCC(CC)OC |
| InChI | InChI=1S/C11H23ClO/c1-4-10(12)8-6-7-9-11(5-2)13-3/h10-11H,4-9H2,1-3H3 |
| InChIKey | URFJXZHDNIZWCT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-8-methoxydecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-8-methoxydecane?
The IUPAC name of 3-chloro-8-methoxydecane (CID 552794) is 3-chloro-8-methoxydecane.
What is the SMILES notation for 3-chloro-8-methoxydecane?
The canonical SMILES for 3-chloro-8-methoxydecane is CCC(Cl)CCCCC(CC)OC.
What is the InChIKey of 3-chloro-8-methoxydecane?
The InChIKey is URFJXZHDNIZWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23ClO/c1-4-10(12)8-6-7-9-11(5-2)13-3/h10-11H,4-9H2,1-3H3.
What are the key properties of 3-chloro-8-methoxydecane?
3-chloro-8-methoxydecane has a molecular weight of 206.76 g/mol, XLogP of 3.99, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-8-methoxydecane is sourced from PubChem (CID 552794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).