About 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane
1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane (PubChem CID 55279434) has the molecular formula C9H15ClO3S
and a molecular weight of 238.74 g/mol. Its IUPAC name is 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane |
| PubChem CID | 55279434 |
| Molecular Formula | C9H15ClO3S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane |
| SMILES | CC1(C)C2CCC1(OS(=O)(=O)Cl)CC2 |
| InChI | InChI=1S/C9H15ClO3S/c1-8(2)7-3-5-9(8,6-4-7)13-14(10,11)12/h7H,3-6H2,1-2H3 |
| InChIKey | XAGWUEKADIFAHI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane?
The IUPAC name of 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane (CID 55279434) is 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane.
What is the SMILES notation for 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane?
The canonical SMILES for 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane is CC1(C)C2CCC1(OS(=O)(=O)Cl)CC2.
What is the InChIKey of 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane?
The InChIKey is XAGWUEKADIFAHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClO3S/c1-8(2)7-3-5-9(8,6-4-7)13-14(10,11)12/h7H,3-6H2,1-2H3.
What are the key properties of 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane?
1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane has a molecular weight of 238.74 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane is sourced from PubChem (CID 55279434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).