3-chloro-6-methoxypyridine-2-sulfonyl chloride

C6H5Cl2NO3S — CID 55279487

IUPAC3-chloro-6-methoxypyridine-2-sulfonyl chloride
SMILESCOc1ccc(Cl)c(S(=O)(=O)Cl)n1
InChIInChI=1S/C6H5Cl2NO3S/c1-12-5-3-2-4(7)6(9-5)13(8,10)11/h2-3H,1H3
InChIKeyBBZSAPQFFOXSMY-UHFFFAOYSA-N
MW242.08 g/mol
LogP1.67
Rot. Bonds2

About 3-chloro-6-methoxypyridine-2-sulfonyl chloride

3-chloro-6-methoxypyridine-2-sulfonyl chloride (PubChem CID 55279487) has the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. Its IUPAC name is 3-chloro-6-methoxypyridine-2-sulfonyl chloride.

Molecular Properties

Compound Name3-chloro-6-methoxypyridine-2-sulfonyl chloride
PubChem CID55279487
Molecular FormulaC6H5Cl2NO3S
Molecular Weight242.08 g/mol
Exact Mass240.94
IUPAC Name3-chloro-6-methoxypyridine-2-sulfonyl chloride
SMILESCOc1ccc(Cl)c(S(=O)(=O)Cl)n1
InChIInChI=1S/C6H5Cl2NO3S/c1-12-5-3-2-4(7)6(9-5)13(8,10)11/h2-3H,1H3
InChIKeyBBZSAPQFFOXSMY-UHFFFAOYSA-N
XLogP1.67
TPSA56.26 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.08
LogP ≤ 51.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 3-chloro-6-methoxypyridine-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-6-methoxypyridine-2-sulfonyl chloride?
The IUPAC name of 3-chloro-6-methoxypyridine-2-sulfonyl chloride (CID 55279487) is 3-chloro-6-methoxypyridine-2-sulfonyl chloride.
What is the SMILES notation for 3-chloro-6-methoxypyridine-2-sulfonyl chloride?
The canonical SMILES for 3-chloro-6-methoxypyridine-2-sulfonyl chloride is COc1ccc(Cl)c(S(=O)(=O)Cl)n1.
What is the InChIKey of 3-chloro-6-methoxypyridine-2-sulfonyl chloride?
The InChIKey is BBZSAPQFFOXSMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2NO3S/c1-12-5-3-2-4(7)6(9-5)13(8,10)11/h2-3H,1H3.
What are the key properties of 3-chloro-6-methoxypyridine-2-sulfonyl chloride?
3-chloro-6-methoxypyridine-2-sulfonyl chloride has a molecular weight of 242.08 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-methoxypyridine-2-sulfonyl chloride is sourced from PubChem (CID 55279487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).