C6H9N7 — CID 55279502
(1,3-dimethylpyrazolo[4,5-e][1,2,4]triazin-5-yl)hydrazine (PubChem CID 55279502) has the molecular formula C6H9N7 and a molecular weight of 179.19 g/mol. Its IUPAC name is (1,3-dimethylpyrazolo[4,5-e][1,2,4]triazin-5-yl)hydrazine.
| Compound Name | (1,3-dimethylpyrazolo[4,5-e][1,2,4]triazin-5-yl)hydrazine |
|---|---|
| PubChem CID | 55279502 |
| Molecular Formula | C6H9N7 |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (1,3-dimethylpyrazolo[4,5-e][1,2,4]triazin-5-yl)hydrazine |
| SMILES | Cc1nn(C)c2nnc(NN)nc12 |
| InChI | InChI=1S/C6H9N7/c1-3-4-5(13(2)12-3)10-11-6(8-4)9-7/h7H2,1-2H3,(H,8,9,11) |
| InChIKey | OCZSZZUFXCMOAN-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|