2-cyanopropane-2-sulfonyl chloride

C4H6ClNO2S — CID 55279680

IUPAC2-cyanopropane-2-sulfonyl chloride
SMILESCC(C)(C#N)S(=O)(=O)Cl
InChIInChI=1S/C4H6ClNO2S/c1-4(2,3-6)9(5,7)8/h1-2H3
InChIKeyWYYCQTCXKZJACX-UHFFFAOYSA-N
MW167.62 g/mol
LogP0.86
Rot. Bonds1

About 2-cyanopropane-2-sulfonyl chloride

2-cyanopropane-2-sulfonyl chloride (PubChem CID 55279680) has the molecular formula C4H6ClNO2S and a molecular weight of 167.62 g/mol. Its IUPAC name is 2-cyanopropane-2-sulfonyl chloride.

Molecular Properties

Compound Name2-cyanopropane-2-sulfonyl chloride
PubChem CID55279680
Molecular FormulaC4H6ClNO2S
Molecular Weight167.62 g/mol
Exact Mass166.98
IUPAC Name2-cyanopropane-2-sulfonyl chloride
SMILESCC(C)(C#N)S(=O)(=O)Cl
InChIInChI=1S/C4H6ClNO2S/c1-4(2,3-6)9(5,7)8/h1-2H3
InChIKeyWYYCQTCXKZJACX-UHFFFAOYSA-N
XLogP0.86
TPSA57.93 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.62
LogP ≤ 50.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2-cyanopropane-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyanopropane-2-sulfonyl chloride?
The IUPAC name of 2-cyanopropane-2-sulfonyl chloride (CID 55279680) is 2-cyanopropane-2-sulfonyl chloride.
What is the SMILES notation for 2-cyanopropane-2-sulfonyl chloride?
The canonical SMILES for 2-cyanopropane-2-sulfonyl chloride is CC(C)(C#N)S(=O)(=O)Cl.
What is the InChIKey of 2-cyanopropane-2-sulfonyl chloride?
The InChIKey is WYYCQTCXKZJACX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6ClNO2S/c1-4(2,3-6)9(5,7)8/h1-2H3.
What are the key properties of 2-cyanopropane-2-sulfonyl chloride?
2-cyanopropane-2-sulfonyl chloride has a molecular weight of 167.62 g/mol, XLogP of 0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanopropane-2-sulfonyl chloride is sourced from PubChem (CID 55279680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).