About 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine
8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine (PubChem CID 55279760) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine.
Molecular Properties
| Compound Name | 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine |
| PubChem CID | 55279760 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine |
| SMILES | NNC1CC2C3CC4C2C4C13 |
| InChI | InChI=1S/C9H14N2/c10-11-6-2-4-3-1-5-7(4)9(5)8(3)6/h3-9,11H,1-2,10H2 |
| InChIKey | LDFJJDGSLMREAY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine?
The IUPAC name of 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine (CID 55279760) is 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine.
What is the SMILES notation for 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine?
The canonical SMILES for 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine is NNC1CC2C3CC4C2C4C13.
What is the InChIKey of 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine?
The InChIKey is LDFJJDGSLMREAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c10-11-6-2-4-3-1-5-7(4)9(5)8(3)6/h3-9,11H,1-2,10H2.
What are the key properties of 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine?
8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine has a molecular weight of 150.22 g/mol, XLogP of 0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tetracyclo[4.3.0.02,4.03,7]nonanylhydrazine is sourced from PubChem (CID 55279760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).