About 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride
2-hydroxy-3,5-dimethylbenzenesulfonyl chloride (PubChem CID 55279813) has the molecular formula C8H9ClO3S
and a molecular weight of 220.68 g/mol. Its IUPAC name is 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride |
| PubChem CID | 55279813 |
| Molecular Formula | C8H9ClO3S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride |
| SMILES | Cc1cc(C)c(O)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C8H9ClO3S/c1-5-3-6(2)8(10)7(4-5)13(9,11)12/h3-4,10H,1-2H3 |
| InChIKey | VDCHDSXNEUWUGQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride?
The IUPAC name of 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride (CID 55279813) is 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride.
What is the SMILES notation for 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride?
The canonical SMILES for 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride is Cc1cc(C)c(O)c(S(=O)(=O)Cl)c1.
What is the InChIKey of 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride?
The InChIKey is VDCHDSXNEUWUGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO3S/c1-5-3-6(2)8(10)7(4-5)13(9,11)12/h3-4,10H,1-2H3.
What are the key properties of 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride?
2-hydroxy-3,5-dimethylbenzenesulfonyl chloride has a molecular weight of 220.68 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride is sourced from PubChem (CID 55279813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).