About (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride
(2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride (PubChem CID 55279909) has the molecular formula C6H12ClNO3S
and a molecular weight of 213.69 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride.
Molecular Properties
| Compound Name | (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride |
| PubChem CID | 55279909 |
| Molecular Formula | C6H12ClNO3S |
| Molecular Weight | 213.69 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride |
| SMILES | C[C@@H]1CN(S(=O)(=O)Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C6H12ClNO3S/c1-5-3-8(12(7,9)10)4-6(2)11-5/h5-6H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | IOHUKINMPIUAFU-OLQVQODUSA-N |
| XLogP | 0.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.69 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride?
The IUPAC name of (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride (CID 55279909) is (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride.
What is the SMILES notation for (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride?
The canonical SMILES for (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride is C[C@@H]1CN(S(=O)(=O)Cl)C[C@H](C)O1.
What is the InChIKey of (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride?
The InChIKey is IOHUKINMPIUAFU-OLQVQODUSA-N. The full InChI is InChI=1S/C6H12ClNO3S/c1-5-3-8(12(7,9)10)4-6(2)11-5/h5-6H,3-4H2,1-2H3/t5-,6+.
What are the key properties of (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride?
(2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride has a molecular weight of 213.69 g/mol, XLogP of 0.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride is sourced from PubChem (CID 55279909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).