N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride

C5H13ClN2O2S — CID 55279940

IUPACN-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride
SMILESCN(C)CCN(C)S(=O)(=O)Cl
InChIInChI=1S/C5H13ClN2O2S/c1-7(2)4-5-8(3)11(6,9)10/h4-5H2,1-3H3
InChIKeyVZICGTDPCIGJPF-UHFFFAOYSA-N
MW200.69 g/mol
LogP-0.04
Rot. Bonds4

About N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride

N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride (PubChem CID 55279940) has the molecular formula C5H13ClN2O2S and a molecular weight of 200.69 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride.

Molecular Properties

Compound NameN-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride
PubChem CID55279940
Molecular FormulaC5H13ClN2O2S
Molecular Weight200.69 g/mol
Exact Mass200.04
IUPAC NameN-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride
SMILESCN(C)CCN(C)S(=O)(=O)Cl
InChIInChI=1S/C5H13ClN2O2S/c1-7(2)4-5-8(3)11(6,9)10/h4-5H2,1-3H3
InChIKeyVZICGTDPCIGJPF-UHFFFAOYSA-N
XLogP-0.04
TPSA40.62 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.69
LogP ≤ 5-0.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride?
The IUPAC name of N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride (CID 55279940) is N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride.
What is the SMILES notation for N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride?
The canonical SMILES for N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride is CN(C)CCN(C)S(=O)(=O)Cl.
What is the InChIKey of N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride?
The InChIKey is VZICGTDPCIGJPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13ClN2O2S/c1-7(2)4-5-8(3)11(6,9)10/h4-5H2,1-3H3.
What are the key properties of N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride?
N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride has a molecular weight of 200.69 g/mol, XLogP of -0.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)ethyl]-N-methylsulfamoyl chloride is sourced from PubChem (CID 55279940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).