About N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride
N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride (PubChem CID 55279942) has the molecular formula C7H16ClNO2S
and a molecular weight of 213.73 g/mol. Its IUPAC name is N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride.
Molecular Properties
| Compound Name | N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride |
| PubChem CID | 55279942 |
| Molecular Formula | C7H16ClNO2S |
| Molecular Weight | 213.73 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride |
| SMILES | CC(C)(C)C(C)(C)NS(=O)(=O)Cl |
| InChI | InChI=1S/C7H16ClNO2S/c1-6(2,3)7(4,5)9-12(8,10)11/h9H,1-5H3 |
| InChIKey | CXPXYAZEKAGJDM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.73 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride?
The IUPAC name of N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride (CID 55279942) is N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride.
What is the SMILES notation for N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride?
The canonical SMILES for N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride is CC(C)(C)C(C)(C)NS(=O)(=O)Cl.
What is the InChIKey of N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride?
The InChIKey is CXPXYAZEKAGJDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16ClNO2S/c1-6(2,3)7(4,5)9-12(8,10)11/h9H,1-5H3.
What are the key properties of N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride?
N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride has a molecular weight of 213.73 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3,3-trimethylbutan-2-yl)sulfamoyl chloride is sourced from PubChem (CID 55279942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).