About (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine
(6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine (PubChem CID 55280081) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine.
Molecular Properties
| Compound Name | (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine |
| PubChem CID | 55280081 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine |
| SMILES | COc1nc(C)nc(NN)c1C |
| InChI | InChI=1S/C7H12N4O/c1-4-6(11-8)9-5(2)10-7(4)12-3/h8H2,1-3H3,(H,9,10,11) |
| InChIKey | UAFNGAIUQAZRLF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine?
The IUPAC name of (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine (CID 55280081) is (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine.
What is the SMILES notation for (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine?
The canonical SMILES for (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine is COc1nc(C)nc(NN)c1C.
What is the InChIKey of (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine?
The InChIKey is UAFNGAIUQAZRLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O/c1-4-6(11-8)9-5(2)10-7(4)12-3/h8H2,1-3H3,(H,9,10,11).
What are the key properties of (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine?
(6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine has a molecular weight of 168.20 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methoxy-2,5-dimethylpyrimidin-4-yl)hydrazine is sourced from PubChem (CID 55280081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).