3-chloro-2,2-dimethylpropane-1-sulfonyl chloride

C5H10Cl2O2S — CID 55280263

IUPAC3-chloro-2,2-dimethylpropane-1-sulfonyl chloride
SMILESCC(C)(CCl)CS(=O)(=O)Cl
InChIInChI=1S/C5H10Cl2O2S/c1-5(2,3-6)4-10(7,8)9/h3-4H2,1-2H3
InChIKeyCPRQLKSYBAJLSU-UHFFFAOYSA-N
MW205.11 g/mol
LogP1.82
Rot. Bonds3

About 3-chloro-2,2-dimethylpropane-1-sulfonyl chloride

3-chloro-2,2-dimethylpropane-1-sulfonyl chloride (PubChem CID 55280263) has the molecular formula C5H10Cl2O2S and a molecular weight of 205.11 g/mol. Its IUPAC name is 3-chloro-2,2-dimethylpropane-1-sulfonyl chloride.

Molecular Properties

Compound Name3-chloro-2,2-dimethylpropane-1-sulfonyl chloride
PubChem CID55280263
Molecular FormulaC5H10Cl2O2S
Molecular Weight205.11 g/mol
Exact Mass203.98
IUPAC Name3-chloro-2,2-dimethylpropane-1-sulfonyl chloride
SMILESCC(C)(CCl)CS(=O)(=O)Cl
InChIInChI=1S/C5H10Cl2O2S/c1-5(2,3-6)4-10(7,8)9/h3-4H2,1-2H3
InChIKeyCPRQLKSYBAJLSU-UHFFFAOYSA-N
XLogP1.82
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.11
LogP ≤ 51.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 3-chloro-2,2-dimethylpropane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-2,2-dimethylpropane-1-sulfonyl chloride?
The IUPAC name of 3-chloro-2,2-dimethylpropane-1-sulfonyl chloride (CID 55280263) is 3-chloro-2,2-dimethylpropane-1-sulfonyl chloride.
What is the SMILES notation for 3-chloro-2,2-dimethylpropane-1-sulfonyl chloride?
The canonical SMILES for 3-chloro-2,2-dimethylpropane-1-sulfonyl chloride is CC(C)(CCl)CS(=O)(=O)Cl.
What is the InChIKey of 3-chloro-2,2-dimethylpropane-1-sulfonyl chloride?
The InChIKey is CPRQLKSYBAJLSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10Cl2O2S/c1-5(2,3-6)4-10(7,8)9/h3-4H2,1-2H3.
What are the key properties of 3-chloro-2,2-dimethylpropane-1-sulfonyl chloride?
3-chloro-2,2-dimethylpropane-1-sulfonyl chloride has a molecular weight of 205.11 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,2-dimethylpropane-1-sulfonyl chloride is sourced from PubChem (CID 55280263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).