About 1-amino-2,3-dipropylguanidine
1-amino-2,3-dipropylguanidine (PubChem CID 55280464) has the molecular formula C7H18N4
and a molecular weight of 158.25 g/mol. Its IUPAC name is 1-amino-2,3-dipropylguanidine.
Molecular Properties
| Compound Name | 1-amino-2,3-dipropylguanidine |
| PubChem CID | 55280464 |
| Molecular Formula | C7H18N4 |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | 1-amino-2,3-dipropylguanidine |
| SMILES | CCC/N=C(\NN)NCCC |
| InChI | InChI=1S/C7H18N4/c1-3-5-9-7(11-8)10-6-4-2/h3-6,8H2,1-2H3,(H2,9,10,11) |
| InChIKey | GDWKMYUQJAOYJG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2,3-dipropylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2,3-dipropylguanidine?
The IUPAC name of 1-amino-2,3-dipropylguanidine (CID 55280464) is 1-amino-2,3-dipropylguanidine.
What is the SMILES notation for 1-amino-2,3-dipropylguanidine?
The canonical SMILES for 1-amino-2,3-dipropylguanidine is CCC/N=C(\NN)NCCC.
What is the InChIKey of 1-amino-2,3-dipropylguanidine?
The InChIKey is GDWKMYUQJAOYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N4/c1-3-5-9-7(11-8)10-6-4-2/h3-6,8H2,1-2H3,(H2,9,10,11).
What are the key properties of 1-amino-2,3-dipropylguanidine?
1-amino-2,3-dipropylguanidine has a molecular weight of 158.25 g/mol, XLogP of 0.22, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2,3-dipropylguanidine is sourced from PubChem (CID 55280464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).