About 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione
10-azatricyclo[5.4.0.01,5]undecane-4,11-dione (PubChem CID 55280629) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione.
Molecular Properties
| Compound Name | 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione |
| PubChem CID | 55280629 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione |
| SMILES | O=C1CCC23C(=O)NCCC2CC13 |
| InChI | InChI=1S/C10H13NO2/c12-8-1-3-10-6(5-7(8)10)2-4-11-9(10)13/h6-7H,1-5H2,(H,11,13) |
| InChIKey | RCUTVULYCSRHGI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione?
The IUPAC name of 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione (CID 55280629) is 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione.
What is the SMILES notation for 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione?
The canonical SMILES for 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione is O=C1CCC23C(=O)NCCC2CC13.
What is the InChIKey of 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione?
The InChIKey is RCUTVULYCSRHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c12-8-1-3-10-6(5-7(8)10)2-4-11-9(10)13/h6-7H,1-5H2,(H,11,13).
What are the key properties of 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione?
10-azatricyclo[5.4.0.01,5]undecane-4,11-dione has a molecular weight of 179.22 g/mol, XLogP of 0.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-azatricyclo[5.4.0.01,5]undecane-4,11-dione is sourced from PubChem (CID 55280629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).