N-chlorosulfonyl-N-methylsulfamoyl chloride

CH3Cl2NO4S2 — CID 55280646

IUPACN-chlorosulfonyl-N-methylsulfamoyl chloride
SMILESCN(S(=O)(=O)Cl)S(=O)(=O)Cl
InChIInChI=1S/CH3Cl2NO4S2/c1-4(9(2,5)6)10(3,7)8/h1H3
InChIKeyOODASNYBSOTGHS-UHFFFAOYSA-N
MW228.08 g/mol
LogP-0.11
Rot. Bonds2

About N-chlorosulfonyl-N-methylsulfamoyl chloride

N-chlorosulfonyl-N-methylsulfamoyl chloride (PubChem CID 55280646) has the molecular formula CH3Cl2NO4S2 and a molecular weight of 228.08 g/mol. Its IUPAC name is N-chlorosulfonyl-N-methylsulfamoyl chloride.

Molecular Properties

Compound NameN-chlorosulfonyl-N-methylsulfamoyl chloride
PubChem CID55280646
Molecular FormulaCH3Cl2NO4S2
Molecular Weight228.08 g/mol
Exact Mass226.89
IUPAC NameN-chlorosulfonyl-N-methylsulfamoyl chloride
SMILESCN(S(=O)(=O)Cl)S(=O)(=O)Cl
InChIInChI=1S/CH3Cl2NO4S2/c1-4(9(2,5)6)10(3,7)8/h1H3
InChIKeyOODASNYBSOTGHS-UHFFFAOYSA-N
XLogP-0.11
TPSA71.52 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.08
LogP ≤ 5-0.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze N-chlorosulfonyl-N-methylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

N-methyl-N-sulfonatosulfamate
CID 5258384

Frequently Asked Questions

What is the IUPAC name of N-chlorosulfonyl-N-methylsulfamoyl chloride?
The IUPAC name of N-chlorosulfonyl-N-methylsulfamoyl chloride (CID 55280646) is N-chlorosulfonyl-N-methylsulfamoyl chloride.
What is the SMILES notation for N-chlorosulfonyl-N-methylsulfamoyl chloride?
The canonical SMILES for N-chlorosulfonyl-N-methylsulfamoyl chloride is CN(S(=O)(=O)Cl)S(=O)(=O)Cl.
What is the InChIKey of N-chlorosulfonyl-N-methylsulfamoyl chloride?
The InChIKey is OODASNYBSOTGHS-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3Cl2NO4S2/c1-4(9(2,5)6)10(3,7)8/h1H3.
What are the key properties of N-chlorosulfonyl-N-methylsulfamoyl chloride?
N-chlorosulfonyl-N-methylsulfamoyl chloride has a molecular weight of 228.08 g/mol, XLogP of -0.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-chlorosulfonyl-N-methylsulfamoyl chloride is sourced from PubChem (CID 55280646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).