About 4-fluoro-6-methoxy-1,3,5-triazin-2-amine
4-fluoro-6-methoxy-1,3,5-triazin-2-amine (PubChem CID 55281091) has the molecular formula C4H5FN4O
and a molecular weight of 144.11 g/mol. Its IUPAC name is 4-fluoro-6-methoxy-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-fluoro-6-methoxy-1,3,5-triazin-2-amine |
| PubChem CID | 55281091 |
| Molecular Formula | C4H5FN4O |
| Molecular Weight | 144.11 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 4-fluoro-6-methoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N)nc(F)n1 |
| InChI | InChI=1S/C4H5FN4O/c1-10-4-8-2(5)7-3(6)9-4/h1H3,(H2,6,7,8,9) |
| InChIKey | SWWYJSNCUQQOQU-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.11 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-fluoro-6-methoxy-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-6-methoxy-1,3,5-triazin-2-amine?
The IUPAC name of 4-fluoro-6-methoxy-1,3,5-triazin-2-amine (CID 55281091) is 4-fluoro-6-methoxy-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-fluoro-6-methoxy-1,3,5-triazin-2-amine?
The canonical SMILES for 4-fluoro-6-methoxy-1,3,5-triazin-2-amine is COc1nc(N)nc(F)n1.
What is the InChIKey of 4-fluoro-6-methoxy-1,3,5-triazin-2-amine?
The InChIKey is SWWYJSNCUQQOQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5FN4O/c1-10-4-8-2(5)7-3(6)9-4/h1H3,(H2,6,7,8,9).
What are the key properties of 4-fluoro-6-methoxy-1,3,5-triazin-2-amine?
4-fluoro-6-methoxy-1,3,5-triazin-2-amine has a molecular weight of 144.11 g/mol, XLogP of -0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-6-methoxy-1,3,5-triazin-2-amine is sourced from PubChem (CID 55281091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).