About 3-methanimidoylaniline
3-methanimidoylaniline (PubChem CID 55281167) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 3-methanimidoylaniline.
Molecular Properties
| Compound Name | 3-methanimidoylaniline |
| PubChem CID | 55281167 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 3-methanimidoylaniline |
| SMILES | [H]/N=C/c1cccc(N)c1 |
| InChI | InChI=1S/C7H8N2/c8-5-6-2-1-3-7(9)4-6/h1-5,8H,9H2/b8-5+ |
| InChIKey | KYMMCNSYMGPQSC-VMPITWQZSA-N |
| XLogP | 1.27 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methanimidoylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methanimidoylaniline?
The IUPAC name of 3-methanimidoylaniline (CID 55281167) is 3-methanimidoylaniline.
What is the SMILES notation for 3-methanimidoylaniline?
The canonical SMILES for 3-methanimidoylaniline is [H]/N=C/c1cccc(N)c1.
What is the InChIKey of 3-methanimidoylaniline?
The InChIKey is KYMMCNSYMGPQSC-VMPITWQZSA-N. The full InChI is InChI=1S/C7H8N2/c8-5-6-2-1-3-7(9)4-6/h1-5,8H,9H2/b8-5+.
What are the key properties of 3-methanimidoylaniline?
3-methanimidoylaniline has a molecular weight of 120.15 g/mol, XLogP of 1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methanimidoylaniline is sourced from PubChem (CID 55281167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).