C4H8N4S — CID 55281762
5-N-ethyl-1,2,4-thiadiazole-3,5-diamine (PubChem CID 55281762) has the molecular formula C4H8N4S and a molecular weight of 144.20 g/mol. Its IUPAC name is 5-N-ethyl-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-ethyl-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 55281762 |
| Molecular Formula | C4H8N4S |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 5-N-ethyl-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CCNc1nc(N)ns1 |
| InChI | InChI=1S/C4H8N4S/c1-2-6-4-7-3(5)8-9-4/h2H2,1H3,(H3,5,6,7,8) |
| InChIKey | CJWMEIISLUCKAO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |