About pyrido[3,2-d]pyrimidin-4-amine
pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 55281763) has the molecular formula C7H6N4
and a molecular weight of 146.15 g/mol. Its IUPAC name is pyrido[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | pyrido[3,2-d]pyrimidin-4-amine |
| PubChem CID | 55281763 |
| Molecular Formula | C7H6N4 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2cccnc12 |
| InChI | InChI=1S/C7H6N4/c8-7-6-5(10-4-11-7)2-1-3-9-6/h1-4H,(H2,8,10,11) |
| InChIKey | DGXAOSOMFMODCF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrido[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[3,2-d]pyrimidin-4-amine?
The IUPAC name of pyrido[3,2-d]pyrimidin-4-amine (CID 55281763) is pyrido[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for pyrido[3,2-d]pyrimidin-4-amine?
The canonical SMILES for pyrido[3,2-d]pyrimidin-4-amine is Nc1ncnc2cccnc12.
What is the InChIKey of pyrido[3,2-d]pyrimidin-4-amine?
The InChIKey is DGXAOSOMFMODCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4/c8-7-6-5(10-4-11-7)2-1-3-9-6/h1-4H,(H2,8,10,11).
What are the key properties of pyrido[3,2-d]pyrimidin-4-amine?
pyrido[3,2-d]pyrimidin-4-amine has a molecular weight of 146.15 g/mol, XLogP of 0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 55281763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).