About (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one
(4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one (PubChem CID 55281771) has the molecular formula C4H8N2O2
and a molecular weight of 116.12 g/mol. Its IUPAC name is (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one.
Molecular Properties
| Compound Name | (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one |
| PubChem CID | 55281771 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one |
| SMILES | C[C@H]1ONC(=O)[C@H]1N |
| InChI | InChI=1S/C4H8N2O2/c1-2-3(5)4(7)6-8-2/h2-3H,5H2,1H3,(H,6,7)/t2-,3+/m1/s1 |
| InChIKey | XGLVMBYXUCUGCI-GBXIJSLDSA-N |
| XLogP | -1.24 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one?
The IUPAC name of (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one (CID 55281771) is (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one.
What is the SMILES notation for (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one?
The canonical SMILES for (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one is C[C@H]1ONC(=O)[C@H]1N.
What is the InChIKey of (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one?
The InChIKey is XGLVMBYXUCUGCI-GBXIJSLDSA-N. The full InChI is InChI=1S/C4H8N2O2/c1-2-3(5)4(7)6-8-2/h2-3H,5H2,1H3,(H,6,7)/t2-,3+/m1/s1.
What are the key properties of (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one?
(4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one has a molecular weight of 116.12 g/mol, XLogP of -1.24, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-4-amino-5-methyl-1,2-oxazolidin-3-one is sourced from PubChem (CID 55281771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).