C7H10N2O — CID 55281822
4,5,6,7-tetrahydro-1,2-benzoxazol-3-amine (PubChem CID 55281822) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1,2-benzoxazol-3-amine.
| Compound Name | 4,5,6,7-tetrahydro-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 55281822 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 4,5,6,7-tetrahydro-1,2-benzoxazol-3-amine |
| SMILES | Nc1noc2c1CCCC2 |
| InChI | InChI=1S/C7H10N2O/c8-7-5-3-1-2-4-6(5)10-9-7/h1-4H2,(H2,8,9) |
| InChIKey | YTMJNWHCBGFYPZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |