About 6-oxo-2,3-dihydropyran-4-carboxamide
6-oxo-2,3-dihydropyran-4-carboxamide (PubChem CID 55282040) has the molecular formula C6H7NO3
and a molecular weight of 141.13 g/mol. Its IUPAC name is 6-oxo-2,3-dihydropyran-4-carboxamide.
Molecular Properties
| Compound Name | 6-oxo-2,3-dihydropyran-4-carboxamide |
| PubChem CID | 55282040 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 6-oxo-2,3-dihydropyran-4-carboxamide |
| SMILES | NC(=O)C1=CC(=O)OCC1 |
| InChI | InChI=1S/C6H7NO3/c7-6(9)4-1-2-10-5(8)3-4/h3H,1-2H2,(H2,7,9) |
| InChIKey | GFRDFIQEUBNRHA-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-oxo-2,3-dihydropyran-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-2,3-dihydropyran-4-carboxamide?
The IUPAC name of 6-oxo-2,3-dihydropyran-4-carboxamide (CID 55282040) is 6-oxo-2,3-dihydropyran-4-carboxamide.
What is the SMILES notation for 6-oxo-2,3-dihydropyran-4-carboxamide?
The canonical SMILES for 6-oxo-2,3-dihydropyran-4-carboxamide is NC(=O)C1=CC(=O)OCC1.
What is the InChIKey of 6-oxo-2,3-dihydropyran-4-carboxamide?
The InChIKey is GFRDFIQEUBNRHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c7-6(9)4-1-2-10-5(8)3-4/h3H,1-2H2,(H2,7,9).
What are the key properties of 6-oxo-2,3-dihydropyran-4-carboxamide?
6-oxo-2,3-dihydropyran-4-carboxamide has a molecular weight of 141.13 g/mol, XLogP of -0.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-2,3-dihydropyran-4-carboxamide is sourced from PubChem (CID 55282040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).