About 6-methylpyridazine-3,4-diamine
6-methylpyridazine-3,4-diamine (PubChem CID 55282140) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is 6-methylpyridazine-3,4-diamine.
Molecular Properties
| Compound Name | 6-methylpyridazine-3,4-diamine |
| PubChem CID | 55282140 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 6-methylpyridazine-3,4-diamine |
| SMILES | Cc1cc(N)c(N)nn1 |
| InChI | InChI=1S/C5H8N4/c1-3-2-4(6)5(7)9-8-3/h2H,1H3,(H2,6,8)(H2,7,9) |
| InChIKey | MDHGDLDUDZCXLA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methylpyridazine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylpyridazine-3,4-diamine?
The IUPAC name of 6-methylpyridazine-3,4-diamine (CID 55282140) is 6-methylpyridazine-3,4-diamine.
What is the SMILES notation for 6-methylpyridazine-3,4-diamine?
The canonical SMILES for 6-methylpyridazine-3,4-diamine is Cc1cc(N)c(N)nn1.
What is the InChIKey of 6-methylpyridazine-3,4-diamine?
The InChIKey is MDHGDLDUDZCXLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4/c1-3-2-4(6)5(7)9-8-3/h2H,1H3,(H2,6,8)(H2,7,9).
What are the key properties of 6-methylpyridazine-3,4-diamine?
6-methylpyridazine-3,4-diamine has a molecular weight of 124.15 g/mol, XLogP of -0.05, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpyridazine-3,4-diamine is sourced from PubChem (CID 55282140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).