About 2-(azetidin-2-yl)phenol
2-(azetidin-2-yl)phenol (PubChem CID 55282316) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-(azetidin-2-yl)phenol.
Molecular Properties
| Compound Name | 2-(azetidin-2-yl)phenol |
| PubChem CID | 55282316 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2-(azetidin-2-yl)phenol |
| SMILES | Oc1ccccc1C1CCN1 |
| InChI | InChI=1S/C9H11NO/c11-9-4-2-1-3-7(9)8-5-6-10-8/h1-4,8,10-11H,5-6H2 |
| InChIKey | JWJXBYRERUVKHY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(azetidin-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-2-yl)phenol?
The IUPAC name of 2-(azetidin-2-yl)phenol (CID 55282316) is 2-(azetidin-2-yl)phenol.
What is the SMILES notation for 2-(azetidin-2-yl)phenol?
The canonical SMILES for 2-(azetidin-2-yl)phenol is Oc1ccccc1C1CCN1.
What is the InChIKey of 2-(azetidin-2-yl)phenol?
The InChIKey is JWJXBYRERUVKHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c11-9-4-2-1-3-7(9)8-5-6-10-8/h1-4,8,10-11H,5-6H2.
What are the key properties of 2-(azetidin-2-yl)phenol?
2-(azetidin-2-yl)phenol has a molecular weight of 149.19 g/mol, XLogP of 1.43, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-2-yl)phenol is sourced from PubChem (CID 55282316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).