About 7H-furo[3,2-c]pyridine-4,6-dione
7H-furo[3,2-c]pyridine-4,6-dione (PubChem CID 55283626) has the molecular formula C7H5NO3
and a molecular weight of 151.12 g/mol. Its IUPAC name is 7H-furo[3,2-c]pyridine-4,6-dione.
Molecular Properties
| Compound Name | 7H-furo[3,2-c]pyridine-4,6-dione |
| PubChem CID | 55283626 |
| Molecular Formula | C7H5NO3 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | 7H-furo[3,2-c]pyridine-4,6-dione |
| SMILES | O=C1Cc2occc2C(=O)N1 |
| InChI | InChI=1S/C7H5NO3/c9-6-3-5-4(1-2-11-5)7(10)8-6/h1-2H,3H2,(H,8,9,10) |
| InChIKey | IZUBYOJWTPLBSX-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 7H-furo[3,2-c]pyridine-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-furo[3,2-c]pyridine-4,6-dione?
The IUPAC name of 7H-furo[3,2-c]pyridine-4,6-dione (CID 55283626) is 7H-furo[3,2-c]pyridine-4,6-dione.
What is the SMILES notation for 7H-furo[3,2-c]pyridine-4,6-dione?
The canonical SMILES for 7H-furo[3,2-c]pyridine-4,6-dione is O=C1Cc2occc2C(=O)N1.
What is the InChIKey of 7H-furo[3,2-c]pyridine-4,6-dione?
The InChIKey is IZUBYOJWTPLBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3/c9-6-3-5-4(1-2-11-5)7(10)8-6/h1-2H,3H2,(H,8,9,10).
What are the key properties of 7H-furo[3,2-c]pyridine-4,6-dione?
7H-furo[3,2-c]pyridine-4,6-dione has a molecular weight of 151.12 g/mol, XLogP of 0.09, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-furo[3,2-c]pyridine-4,6-dione is sourced from PubChem (CID 55283626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).