About (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine
(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine (PubChem CID 55283731) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine.
Molecular Properties
| Compound Name | (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine |
| PubChem CID | 55283731 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine |
| SMILES | CN1CC=C(CN)CC1 |
| InChI | InChI=1S/C7H14N2/c1-9-4-2-7(6-8)3-5-9/h2H,3-6,8H2,1H3 |
| InChIKey | XUELPHBYTUIHJB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine?
The IUPAC name of (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine (CID 55283731) is (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine.
What is the SMILES notation for (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine?
The canonical SMILES for (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine is CN1CC=C(CN)CC1.
What is the InChIKey of (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine?
The InChIKey is XUELPHBYTUIHJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-9-4-2-7(6-8)3-5-9/h2H,3-6,8H2,1H3.
What are the key properties of (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine?
(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine has a molecular weight of 126.20 g/mol, XLogP of 0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanamine is sourced from PubChem (CID 55283731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).