C7H11NS — CID 55283865
(1R,2R,4S,5S,6R)-3-thiatricyclo[3.2.1.02,4]octan-6-amine (PubChem CID 55283865) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is (1R,2R,4S,5S,6R)-3-thiatricyclo[3.2.1.02,4]octan-6-amine.
| Compound Name | (1R,2R,4S,5S,6R)-3-thiatricyclo[3.2.1.02,4]octan-6-amine |
|---|---|
| PubChem CID | 55283865 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | (1R,2R,4S,5S,6R)-3-thiatricyclo[3.2.1.02,4]octan-6-amine |
| SMILES | N[C@@H]1C[C@H]2C[C@@H]1[C@@H]1S[C@H]21 |
| InChI | InChI=1S/C7H11NS/c8-5-2-3-1-4(5)7-6(3)9-7/h3-7H,1-2,8H2/t3-,4+,5-,6-,7+/m1/s1 |
| InChIKey | QDVPILRMKOBMJG-BIVRFLNRSA-N |
| XLogP | 0.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|