About pyrrole-1,2,5-triamine
pyrrole-1,2,5-triamine (PubChem CID 55283951) has the molecular formula C4H8N4
and a molecular weight of 112.14 g/mol. Its IUPAC name is pyrrole-1,2,5-triamine.
Molecular Properties
| Compound Name | pyrrole-1,2,5-triamine |
| PubChem CID | 55283951 |
| Molecular Formula | C4H8N4 |
| Molecular Weight | 112.14 g/mol |
| Exact Mass | 112.07 |
| IUPAC Name | pyrrole-1,2,5-triamine |
| SMILES | Nc1ccc(N)n1N |
| InChI | InChI=1S/C4H8N4/c5-3-1-2-4(6)8(3)7/h1-2H,5-7H2 |
| InChIKey | KRUUURHEDZYKOS-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 82.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.14 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrrole-1,2,5-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrole-1,2,5-triamine?
The IUPAC name of pyrrole-1,2,5-triamine (CID 55283951) is pyrrole-1,2,5-triamine.
What is the SMILES notation for pyrrole-1,2,5-triamine?
The canonical SMILES for pyrrole-1,2,5-triamine is Nc1ccc(N)n1N.
What is the InChIKey of pyrrole-1,2,5-triamine?
The InChIKey is KRUUURHEDZYKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4/c5-3-1-2-4(6)8(3)7/h1-2H,5-7H2.
What are the key properties of pyrrole-1,2,5-triamine?
pyrrole-1,2,5-triamine has a molecular weight of 112.14 g/mol, XLogP of -0.63, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrole-1,2,5-triamine is sourced from PubChem (CID 55283951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).