About 2-(chloroamino)acetamide
2-(chloroamino)acetamide (PubChem CID 55284319) has the molecular formula C2H5ClN2O
and a molecular weight of 108.53 g/mol. Its IUPAC name is 2-(chloroamino)acetamide.
Molecular Properties
| Compound Name | 2-(chloroamino)acetamide |
| PubChem CID | 55284319 |
| Molecular Formula | C2H5ClN2O |
| Molecular Weight | 108.53 g/mol |
| Exact Mass | 108.01 |
| IUPAC Name | 2-(chloroamino)acetamide |
| SMILES | NC(=O)CNCl |
| InChI | InChI=1S/C2H5ClN2O/c3-5-1-2(4)6/h5H,1H2,(H2,4,6) |
| InChIKey | RBCIGRMUCLJCME-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.53 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloroamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloroamino)acetamide?
The IUPAC name of 2-(chloroamino)acetamide (CID 55284319) is 2-(chloroamino)acetamide.
What is the SMILES notation for 2-(chloroamino)acetamide?
The canonical SMILES for 2-(chloroamino)acetamide is NC(=O)CNCl.
What is the InChIKey of 2-(chloroamino)acetamide?
The InChIKey is RBCIGRMUCLJCME-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5ClN2O/c3-5-1-2(4)6/h5H,1H2,(H2,4,6).
What are the key properties of 2-(chloroamino)acetamide?
2-(chloroamino)acetamide has a molecular weight of 108.53 g/mol, XLogP of -0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloroamino)acetamide is sourced from PubChem (CID 55284319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).