About 8-azatricyclo[4.3.0.02,4]nonan-2-amine
8-azatricyclo[4.3.0.02,4]nonan-2-amine (PubChem CID 55284375) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 8-azatricyclo[4.3.0.02,4]nonan-2-amine.
Molecular Properties
| Compound Name | 8-azatricyclo[4.3.0.02,4]nonan-2-amine |
| PubChem CID | 55284375 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 8-azatricyclo[4.3.0.02,4]nonan-2-amine |
| SMILES | NC12CC1CC1CNCC12 |
| InChI | InChI=1S/C8H14N2/c9-8-2-6(8)1-5-3-10-4-7(5)8/h5-7,10H,1-4,9H2 |
| InChIKey | GXLCFBWLUVYDPE-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-azatricyclo[4.3.0.02,4]nonan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-azatricyclo[4.3.0.02,4]nonan-2-amine?
The IUPAC name of 8-azatricyclo[4.3.0.02,4]nonan-2-amine (CID 55284375) is 8-azatricyclo[4.3.0.02,4]nonan-2-amine.
What is the SMILES notation for 8-azatricyclo[4.3.0.02,4]nonan-2-amine?
The canonical SMILES for 8-azatricyclo[4.3.0.02,4]nonan-2-amine is NC12CC1CC1CNCC12.
What is the InChIKey of 8-azatricyclo[4.3.0.02,4]nonan-2-amine?
The InChIKey is GXLCFBWLUVYDPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c9-8-2-6(8)1-5-3-10-4-7(5)8/h5-7,10H,1-4,9H2.
What are the key properties of 8-azatricyclo[4.3.0.02,4]nonan-2-amine?
8-azatricyclo[4.3.0.02,4]nonan-2-amine has a molecular weight of 138.21 g/mol, XLogP of -0.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-azatricyclo[4.3.0.02,4]nonan-2-amine is sourced from PubChem (CID 55284375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).