About (E)-hex-3-enediimidamide
(E)-hex-3-enediimidamide (PubChem CID 55284742) has the molecular formula C6H12N4
and a molecular weight of 140.19 g/mol. Its IUPAC name is (E)-hex-3-enediimidamide.
Molecular Properties
| Compound Name | (E)-hex-3-enediimidamide |
| PubChem CID | 55284742 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | (E)-hex-3-enediimidamide |
| SMILES | [H]/N=C(\N)C/C=C/C/C(N)=N/[H] |
| InChI | InChI=1S/C6H12N4/c7-5(8)3-1-2-4-6(9)10/h1-2H,3-4H2,(H3,7,8)(H3,9,10)/b2-1+ |
| InChIKey | GPXPLPDQEMXRRP-OWOJBTEDSA-N |
| XLogP | 0.19 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-hex-3-enediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-hex-3-enediimidamide?
The IUPAC name of (E)-hex-3-enediimidamide (CID 55284742) is (E)-hex-3-enediimidamide.
What is the SMILES notation for (E)-hex-3-enediimidamide?
The canonical SMILES for (E)-hex-3-enediimidamide is [H]/N=C(\N)C/C=C/C/C(N)=N/[H].
What is the InChIKey of (E)-hex-3-enediimidamide?
The InChIKey is GPXPLPDQEMXRRP-OWOJBTEDSA-N. The full InChI is InChI=1S/C6H12N4/c7-5(8)3-1-2-4-6(9)10/h1-2H,3-4H2,(H3,7,8)(H3,9,10)/b2-1+.
What are the key properties of (E)-hex-3-enediimidamide?
(E)-hex-3-enediimidamide has a molecular weight of 140.19 g/mol, XLogP of 0.19, 4 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-hex-3-enediimidamide is sourced from PubChem (CID 55284742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).