About 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine
4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine (PubChem CID 55284769) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine.
Analyze 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine?
The IUPAC name of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine (CID 55284769) is 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine.
What is the SMILES notation for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine?
The canonical SMILES for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine is NC1CCn2nccc2C1.
What is the InChIKey of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine?
The InChIKey is JJNXSQRHVCZLAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c8-6-2-4-10-7(5-6)1-3-9-10/h1,3,6H,2,4-5,8H2.
What are the key properties of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine?
4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine has a molecular weight of 137.19 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-5-amine is sourced from PubChem (CID 55284769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).