About 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine
5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine (PubChem CID 55284857) has the molecular formula C7H13NS
and a molecular weight of 143.25 g/mol. Its IUPAC name is 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine.
Molecular Properties
| Compound Name | 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine |
| PubChem CID | 55284857 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine |
| SMILES | CCC1=C(C)SCCN1 |
| InChI | InChI=1S/C7H13NS/c1-3-7-6(2)9-5-4-8-7/h8H,3-5H2,1-2H3 |
| InChIKey | OXDUTCIMLYFSKO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine?
The IUPAC name of 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine (CID 55284857) is 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine.
What is the SMILES notation for 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine?
The canonical SMILES for 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine is CCC1=C(C)SCCN1.
What is the InChIKey of 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine?
The InChIKey is OXDUTCIMLYFSKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NS/c1-3-7-6(2)9-5-4-8-7/h8H,3-5H2,1-2H3.
What are the key properties of 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine?
5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine has a molecular weight of 143.25 g/mol, XLogP of 1.96, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-6-methyl-3,4-dihydro-2H-1,4-thiazine is sourced from PubChem (CID 55284857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).