C6H9NO3 — CID 55284858
(1S,2S,4R,5S,6R)-7,9-dioxa-3-azatricyclo[4.2.1.02,4]nonan-5-ol (PubChem CID 55284858) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is (1S,2S,4R,5S,6R)-7,9-dioxa-3-azatricyclo[4.2.1.02,4]nonan-5-ol.
| Compound Name | (1S,2S,4R,5S,6R)-7,9-dioxa-3-azatricyclo[4.2.1.02,4]nonan-5-ol |
|---|---|
| PubChem CID | 55284858 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | (1S,2S,4R,5S,6R)-7,9-dioxa-3-azatricyclo[4.2.1.02,4]nonan-5-ol |
| SMILES | O[C@@H]1[C@@H]2OC[C@@H](O2)[C@H]2N[C@@H]12 |
| InChI | InChI=1S/C6H9NO3/c8-5-4-3(7-4)2-1-9-6(5)10-2/h2-8H,1H2/t2-,3-,4-,5+,6-/m1/s1 |
| InChIKey | APPBNSSAPBESSR-DGPNFKTASA-N |
| XLogP | -1.56 |
| TPSA | 60.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|