About (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine
(Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine (PubChem CID 55284891) has the molecular formula C6H13ClN2
and a molecular weight of 148.64 g/mol. Its IUPAC name is (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine.
Molecular Properties
| Compound Name | (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine |
| PubChem CID | 55284891 |
| Molecular Formula | C6H13ClN2 |
| Molecular Weight | 148.64 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine |
| SMILES | CN(C)C/C(Cl)=C/CN |
| InChI | InChI=1S/C6H13ClN2/c1-9(2)5-6(7)3-4-8/h3H,4-5,8H2,1-2H3/b6-3- |
| InChIKey | PCMZGWWPNBWLEB-UTCJRWHESA-N |
| XLogP | 0.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.64 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine?
The IUPAC name of (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine (CID 55284891) is (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine.
What is the SMILES notation for (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine?
The canonical SMILES for (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine is CN(C)C/C(Cl)=C/CN.
What is the InChIKey of (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine?
The InChIKey is PCMZGWWPNBWLEB-UTCJRWHESA-N. The full InChI is InChI=1S/C6H13ClN2/c1-9(2)5-6(7)3-4-8/h3H,4-5,8H2,1-2H3/b6-3-.
What are the key properties of (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine?
(Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine has a molecular weight of 148.64 g/mol, XLogP of 0.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-chloro-N,N-dimethylbut-2-ene-1,4-diamine is sourced from PubChem (CID 55284891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).