C5H8N2S — CID 55284962
3-N-methylthiophene-3,4-diamine (PubChem CID 55284962) has the molecular formula C5H8N2S and a molecular weight of 128.20 g/mol. Its IUPAC name is 3-N-methylthiophene-3,4-diamine.
| Compound Name | 3-N-methylthiophene-3,4-diamine |
|---|---|
| PubChem CID | 55284962 |
| Molecular Formula | C5H8N2S |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 3-N-methylthiophene-3,4-diamine |
| SMILES | CNc1cscc1N |
| InChI | InChI=1S/C5H8N2S/c1-7-5-3-8-2-4(5)6/h2-3,7H,6H2,1H3 |
| InChIKey | PYWDSZMEVCOBGD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |