About (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine
(2R,3S)-2-methyl-1,1-dioxothiolan-3-amine (PubChem CID 55285059) has the molecular formula C5H11NO2S
and a molecular weight of 149.21 g/mol. Its IUPAC name is (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 55285059 |
| Molecular Formula | C5H11NO2S |
| Molecular Weight | 149.21 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine |
| SMILES | C[C@@H]1[C@@H](N)CCS1(=O)=O |
| InChI | InChI=1S/C5H11NO2S/c1-4-5(6)2-3-9(4,7)8/h4-5H,2-3,6H2,1H3/t4-,5+/m1/s1 |
| InChIKey | AAXIXYQGWDWIIM-UHNVWZDZSA-N |
| XLogP | -0.48 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine?
The IUPAC name of (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine (CID 55285059) is (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine is C[C@@H]1[C@@H](N)CCS1(=O)=O.
What is the InChIKey of (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine?
The InChIKey is AAXIXYQGWDWIIM-UHNVWZDZSA-N. The full InChI is InChI=1S/C5H11NO2S/c1-4-5(6)2-3-9(4,7)8/h4-5H,2-3,6H2,1H3/t4-,5+/m1/s1.
What are the key properties of (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine?
(2R,3S)-2-methyl-1,1-dioxothiolan-3-amine has a molecular weight of 149.21 g/mol, XLogP of -0.48, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-methyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 55285059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).