About (7S)-oct-4-yne-1,7-diamine
(7S)-oct-4-yne-1,7-diamine (PubChem CID 55285298) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (7S)-oct-4-yne-1,7-diamine.
Molecular Properties
| Compound Name | (7S)-oct-4-yne-1,7-diamine |
| PubChem CID | 55285298 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (7S)-oct-4-yne-1,7-diamine |
| SMILES | C[C@H](N)CC#CCCCN |
| InChI | InChI=1S/C8H16N2/c1-8(10)6-4-2-3-5-7-9/h8H,3,5-7,9-10H2,1H3/t8-/m0/s1 |
| InChIKey | ALRWVDMPEJCSHL-QMMMGPOBSA-N |
| XLogP | 0.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (7S)-oct-4-yne-1,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-oct-4-yne-1,7-diamine?
The IUPAC name of (7S)-oct-4-yne-1,7-diamine (CID 55285298) is (7S)-oct-4-yne-1,7-diamine.
What is the SMILES notation for (7S)-oct-4-yne-1,7-diamine?
The canonical SMILES for (7S)-oct-4-yne-1,7-diamine is C[C@H](N)CC#CCCCN.
What is the InChIKey of (7S)-oct-4-yne-1,7-diamine?
The InChIKey is ALRWVDMPEJCSHL-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H16N2/c1-8(10)6-4-2-3-5-7-9/h8H,3,5-7,9-10H2,1H3/t8-/m0/s1.
What are the key properties of (7S)-oct-4-yne-1,7-diamine?
(7S)-oct-4-yne-1,7-diamine has a molecular weight of 140.23 g/mol, XLogP of 0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-oct-4-yne-1,7-diamine is sourced from PubChem (CID 55285298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).