About 4-imino-5-methyl-1,3,5-triazin-2-amine
4-imino-5-methyl-1,3,5-triazin-2-amine (PubChem CID 55285315) has the molecular formula C4H7N5
and a molecular weight of 125.13 g/mol. Its IUPAC name is 4-imino-5-methyl-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-imino-5-methyl-1,3,5-triazin-2-amine |
| PubChem CID | 55285315 |
| Molecular Formula | C4H7N5 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.07 |
| IUPAC Name | 4-imino-5-methyl-1,3,5-triazin-2-amine |
| SMILES | [H]/N=c1\nc(N)ncn1C |
| InChI | InChI=1S/C4H7N5/c1-9-2-7-3(5)8-4(9)6/h2H,1H3,(H3,5,6,8) |
| InChIKey | WEFGPZVEJBZJQU-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-imino-5-methyl-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-5-methyl-1,3,5-triazin-2-amine?
The IUPAC name of 4-imino-5-methyl-1,3,5-triazin-2-amine (CID 55285315) is 4-imino-5-methyl-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-imino-5-methyl-1,3,5-triazin-2-amine?
The canonical SMILES for 4-imino-5-methyl-1,3,5-triazin-2-amine is [H]/N=c1\nc(N)ncn1C.
What is the InChIKey of 4-imino-5-methyl-1,3,5-triazin-2-amine?
The InChIKey is WEFGPZVEJBZJQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5/c1-9-2-7-3(5)8-4(9)6/h2H,1H3,(H3,5,6,8).
What are the key properties of 4-imino-5-methyl-1,3,5-triazin-2-amine?
4-imino-5-methyl-1,3,5-triazin-2-amine has a molecular weight of 125.13 g/mol, XLogP of -1.12, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-5-methyl-1,3,5-triazin-2-amine is sourced from PubChem (CID 55285315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).