C7H8N4 — CID 55285512
2-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 55285512) has the molecular formula C7H8N4 and a molecular weight of 148.17 g/mol. Its IUPAC name is 2-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 55285512 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Cc1nc(N)c2cccn2n1 |
| InChI | InChI=1S/C7H8N4/c1-5-9-7(8)6-3-2-4-11(6)10-5/h2-4H,1H3,(H2,8,9,10) |
| InChIKey | WNZYBEJCEJFTES-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |