About 6-amino-1,4-diazepan-5-one
6-amino-1,4-diazepan-5-one (PubChem CID 55285523) has the molecular formula C5H11N3O
and a molecular weight of 129.16 g/mol. Its IUPAC name is 6-amino-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 6-amino-1,4-diazepan-5-one |
| PubChem CID | 55285523 |
| Molecular Formula | C5H11N3O |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.09 |
| IUPAC Name | 6-amino-1,4-diazepan-5-one |
| SMILES | NC1CNCCNC1=O |
| InChI | InChI=1S/C5H11N3O/c6-4-3-7-1-2-8-5(4)9/h4,7H,1-3,6H2,(H,8,9) |
| InChIKey | XKNMQPGINLBBIB-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,4-diazepan-5-one?
The IUPAC name of 6-amino-1,4-diazepan-5-one (CID 55285523) is 6-amino-1,4-diazepan-5-one.
What is the SMILES notation for 6-amino-1,4-diazepan-5-one?
The canonical SMILES for 6-amino-1,4-diazepan-5-one is NC1CNCCNC1=O.
What is the InChIKey of 6-amino-1,4-diazepan-5-one?
The InChIKey is XKNMQPGINLBBIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O/c6-4-3-7-1-2-8-5(4)9/h4,7H,1-3,6H2,(H,8,9).
What are the key properties of 6-amino-1,4-diazepan-5-one?
6-amino-1,4-diazepan-5-one has a molecular weight of 129.16 g/mol, XLogP of -1.97, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,4-diazepan-5-one is sourced from PubChem (CID 55285523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).