About 4-oxopentan-2-yl carbamate
4-oxopentan-2-yl carbamate (PubChem CID 55285703) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 4-oxopentan-2-yl carbamate.
Molecular Properties
| Compound Name | 4-oxopentan-2-yl carbamate |
| PubChem CID | 55285703 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 4-oxopentan-2-yl carbamate |
| SMILES | CC(=O)CC(C)OC(N)=O |
| InChI | InChI=1S/C6H11NO3/c1-4(8)3-5(2)10-6(7)9/h5H,3H2,1-2H3,(H2,7,9) |
| InChIKey | AKHXLDNJFBWDEW-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-oxopentan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopentan-2-yl carbamate?
The IUPAC name of 4-oxopentan-2-yl carbamate (CID 55285703) is 4-oxopentan-2-yl carbamate.
What is the SMILES notation for 4-oxopentan-2-yl carbamate?
The canonical SMILES for 4-oxopentan-2-yl carbamate is CC(=O)CC(C)OC(N)=O.
What is the InChIKey of 4-oxopentan-2-yl carbamate?
The InChIKey is AKHXLDNJFBWDEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-4(8)3-5(2)10-6(7)9/h5H,3H2,1-2H3,(H2,7,9).
What are the key properties of 4-oxopentan-2-yl carbamate?
4-oxopentan-2-yl carbamate has a molecular weight of 145.16 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopentan-2-yl carbamate is sourced from PubChem (CID 55285703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).