About 2-amino-2-phenylethenone
2-amino-2-phenylethenone (PubChem CID 55285741) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is 2-amino-2-phenylethenone.
Molecular Properties
| Compound Name | 2-amino-2-phenylethenone |
| PubChem CID | 55285741 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 2-amino-2-phenylethenone |
| SMILES | NC(=C=O)c1ccccc1 |
| InChI | InChI=1S/C8H7NO/c9-8(6-10)7-4-2-1-3-5-7/h1-5H,9H2 |
| InChIKey | VWQLTKLRUSVPFM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-phenylethenone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-phenylethenone?
The IUPAC name of 2-amino-2-phenylethenone (CID 55285741) is 2-amino-2-phenylethenone.
What is the SMILES notation for 2-amino-2-phenylethenone?
The canonical SMILES for 2-amino-2-phenylethenone is NC(=C=O)c1ccccc1.
What is the InChIKey of 2-amino-2-phenylethenone?
The InChIKey is VWQLTKLRUSVPFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO/c9-8(6-10)7-4-2-1-3-5-7/h1-5H,9H2.
What are the key properties of 2-amino-2-phenylethenone?
2-amino-2-phenylethenone has a molecular weight of 133.15 g/mol, XLogP of 0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-phenylethenone is sourced from PubChem (CID 55285741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).