C8H14N2 — CID 55285760
(1R,2R,6S)-8-azatricyclo[4.3.0.02,4]nonan-2-amine (PubChem CID 55285760) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (1R,2R,6S)-8-azatricyclo[4.3.0.02,4]nonan-2-amine.
| Compound Name | (1R,2R,6S)-8-azatricyclo[4.3.0.02,4]nonan-2-amine |
|---|---|
| PubChem CID | 55285760 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (1R,2R,6S)-8-azatricyclo[4.3.0.02,4]nonan-2-amine |
| SMILES | N[C@]12CC1C[C@@H]1CNC[C@@H]12 |
| InChI | InChI=1S/C8H14N2/c9-8-2-6(8)1-5-3-10-4-7(5)8/h5-7,10H,1-4,9H2/t5-,6?,7+,8-/m1/s1 |
| InChIKey | GXLCFBWLUVYDPE-SNYGBICDSA-N |
| XLogP | -0.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |