About 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole
2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole (PubChem CID 55286110) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole.
Molecular Properties
| Compound Name | 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole |
| PubChem CID | 55286110 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole |
| SMILES | C1=CC(Cc2ccc[nH]2)=CC1 |
| InChI | InChI=1S/C10H11N/c1-2-5-9(4-1)8-10-6-3-7-11-10/h1,3-7,11H,2,8H2 |
| InChIKey | HDJSUKNCHOYNCT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole?
The IUPAC name of 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole (CID 55286110) is 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole.
What is the SMILES notation for 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole?
The canonical SMILES for 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole is C1=CC(Cc2ccc[nH]2)=CC1.
What is the InChIKey of 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole?
The InChIKey is HDJSUKNCHOYNCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-2-5-9(4-1)8-10-6-3-7-11-10/h1,3-7,11H,2,8H2.
What are the key properties of 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole?
2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole has a molecular weight of 145.20 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrole is sourced from PubChem (CID 55286110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).