About (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one
(2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one (PubChem CID 55286113) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one.
Molecular Properties
| Compound Name | (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one |
| PubChem CID | 55286113 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one |
| SMILES | CC(C)[C@@H]1C=CCC(=O)N1 |
| InChI | InChI=1S/C8H13NO/c1-6(2)7-4-3-5-8(10)9-7/h3-4,6-7H,5H2,1-2H3,(H,9,10)/t7-/m0/s1 |
| InChIKey | VQQIKFKZWCEQMM-ZETCQYMHSA-N |
| XLogP | 1.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one?
The IUPAC name of (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one (CID 55286113) is (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one.
What is the SMILES notation for (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one?
The canonical SMILES for (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one is CC(C)[C@@H]1C=CCC(=O)N1.
What is the InChIKey of (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one?
The InChIKey is VQQIKFKZWCEQMM-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H13NO/c1-6(2)7-4-3-5-8(10)9-7/h3-4,6-7H,5H2,1-2H3,(H,9,10)/t7-/m0/s1.
What are the key properties of (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one?
(2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one has a molecular weight of 139.20 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-propan-2-yl-2,5-dihydro-1H-pyridin-6-one is sourced from PubChem (CID 55286113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).