C3H7N3O3 — CID 55286131
5,6-dihydroxy-1,2,4-triazinan-3-one (PubChem CID 55286131) has the molecular formula C3H7N3O3 and a molecular weight of 133.11 g/mol. Its IUPAC name is 5,6-dihydroxy-1,2,4-triazinan-3-one.
| Compound Name | 5,6-dihydroxy-1,2,4-triazinan-3-one |
|---|---|
| PubChem CID | 55286131 |
| Molecular Formula | C3H7N3O3 |
| Molecular Weight | 133.11 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 5,6-dihydroxy-1,2,4-triazinan-3-one |
| SMILES | O=C1NNC(O)C(O)N1 |
| InChI | InChI=1S/C3H7N3O3/c7-1-2(8)5-6-3(9)4-1/h1-2,5,7-8H,(H2,4,6,9) |
| InChIKey | COPGWJXOTOBKRB-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.11 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |