C8H12N2 — CID 55286145
1,4,4a,5,6,7-hexahydro-1,8-naphthyridine (PubChem CID 55286145) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 1,4,4a,5,6,7-hexahydro-1,8-naphthyridine.
| Compound Name | 1,4,4a,5,6,7-hexahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 55286145 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 1,4,4a,5,6,7-hexahydro-1,8-naphthyridine |
| SMILES | C1=CNC2=NCCCC2C1 |
| InChI | InChI=1S/C8H12N2/c1-3-7-4-2-6-10-8(7)9-5-1/h1,5,7H,2-4,6H2,(H,9,10) |
| InChIKey | FAWYVVOYWSXAIL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |