About 7-azabicyclo[4.2.2]deca-4,9-dien-8-one
7-azabicyclo[4.2.2]deca-4,9-dien-8-one (PubChem CID 55286163) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 7-azabicyclo[4.2.2]deca-4,9-dien-8-one.
Molecular Properties
| Compound Name | 7-azabicyclo[4.2.2]deca-4,9-dien-8-one |
| PubChem CID | 55286163 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 7-azabicyclo[4.2.2]deca-4,9-dien-8-one |
| SMILES | O=C1NC2C=CCCC1C=C2 |
| InChI | InChI=1S/C9H11NO/c11-9-7-3-1-2-4-8(10-9)6-5-7/h2,4-8H,1,3H2,(H,10,11) |
| InChIKey | XZJJWXGNAQIYML-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-azabicyclo[4.2.2]deca-4,9-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azabicyclo[4.2.2]deca-4,9-dien-8-one?
The IUPAC name of 7-azabicyclo[4.2.2]deca-4,9-dien-8-one (CID 55286163) is 7-azabicyclo[4.2.2]deca-4,9-dien-8-one.
What is the SMILES notation for 7-azabicyclo[4.2.2]deca-4,9-dien-8-one?
The canonical SMILES for 7-azabicyclo[4.2.2]deca-4,9-dien-8-one is O=C1NC2C=CCCC1C=C2.
What is the InChIKey of 7-azabicyclo[4.2.2]deca-4,9-dien-8-one?
The InChIKey is XZJJWXGNAQIYML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c11-9-7-3-1-2-4-8(10-9)6-5-7/h2,4-8H,1,3H2,(H,10,11).
What are the key properties of 7-azabicyclo[4.2.2]deca-4,9-dien-8-one?
7-azabicyclo[4.2.2]deca-4,9-dien-8-one has a molecular weight of 149.19 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azabicyclo[4.2.2]deca-4,9-dien-8-one is sourced from PubChem (CID 55286163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).