About 3,4-dimethyl-2,5-dihydropyridin-6-amine
3,4-dimethyl-2,5-dihydropyridin-6-amine (PubChem CID 55286282) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 3,4-dimethyl-2,5-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | 3,4-dimethyl-2,5-dihydropyridin-6-amine |
| PubChem CID | 55286282 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 3,4-dimethyl-2,5-dihydropyridin-6-amine |
| SMILES | CC1=C(C)CC(N)=NC1 |
| InChI | InChI=1S/C7H12N2/c1-5-3-7(8)9-4-6(5)2/h3-4H2,1-2H3,(H2,8,9) |
| InChIKey | NTJGYDSOJVANNW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-2,5-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2,5-dihydropyridin-6-amine?
The IUPAC name of 3,4-dimethyl-2,5-dihydropyridin-6-amine (CID 55286282) is 3,4-dimethyl-2,5-dihydropyridin-6-amine.
What is the SMILES notation for 3,4-dimethyl-2,5-dihydropyridin-6-amine?
The canonical SMILES for 3,4-dimethyl-2,5-dihydropyridin-6-amine is CC1=C(C)CC(N)=NC1.
What is the InChIKey of 3,4-dimethyl-2,5-dihydropyridin-6-amine?
The InChIKey is NTJGYDSOJVANNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-5-3-7(8)9-4-6(5)2/h3-4H2,1-2H3,(H2,8,9).
What are the key properties of 3,4-dimethyl-2,5-dihydropyridin-6-amine?
3,4-dimethyl-2,5-dihydropyridin-6-amine has a molecular weight of 124.19 g/mol, XLogP of 1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2,5-dihydropyridin-6-amine is sourced from PubChem (CID 55286282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).